C18H29NO2 — CID 156860469
N-[2-methyl-3-(6-oxooctyl)phenyl]propanamide;molecular hydrogen (PubChem CID 156860469) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[2-methyl-3-(6-oxooctyl)phenyl]propanamide;molecular hydrogen.
| Compound Name | N-[2-methyl-3-(6-oxooctyl)phenyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 156860469 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[2-methyl-3-(6-oxooctyl)phenyl]propanamide;molecular hydrogen |
| SMILES | CCC(=O)CCCCCc1cccc(NC(=O)CC)c1C.[H][H] |
| InChI | InChI=1S/C18H27NO2.H2/c1-4-16(20)12-8-6-7-10-15-11-9-13-17(14(15)3)19-18(21)5-2;/h9,11,13H,4-8,10,12H2,1-3H3,(H,19,21);1H |
| InChIKey | RQVWXTMGHCYXPX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|