C19H31NOS — CID 87178909
(2,3-dihexylphenyl)carbamothioic S-acid (PubChem CID 87178909) has the molecular formula C19H31NOS and a molecular weight of 321.53 g/mol. Its IUPAC name is (2,3-dihexylphenyl)carbamothioic S-acid.
| Compound Name | (2,3-dihexylphenyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 87178909 |
| Molecular Formula | C19H31NOS |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2,3-dihexylphenyl)carbamothioic S-acid |
| SMILES | CCCCCCc1cccc(NC(=O)S)c1CCCCCC |
| InChI | InChI=1S/C19H31NOS/c1-3-5-7-9-12-16-13-11-15-18(20-19(21)22)17(16)14-10-8-6-4-2/h11,13,15H,3-10,12,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | FOPOZLFPUFEFPM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|