C19H31NO2 — CID 67251451
(2,3-dihexylphenyl)carbamic acid (PubChem CID 67251451) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (2,3-dihexylphenyl)carbamic acid.
| Compound Name | (2,3-dihexylphenyl)carbamic acid |
|---|---|
| PubChem CID | 67251451 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (2,3-dihexylphenyl)carbamic acid |
| SMILES | CCCCCCc1cccc(NC(=O)O)c1CCCCCC |
| InChI | InChI=1S/C19H31NO2/c1-3-5-7-9-12-16-13-11-15-18(20-19(21)22)17(16)14-10-8-6-4-2/h11,13,15,20H,3-10,12,14H2,1-2H3,(H,21,22) |
| InChIKey | SUAWNUWXJHOGGJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|