C16H24N2O2S2Zn — CID 87178982
zinc;N-(2,3-dibutylphenyl)carbamothioate;carbamothioate (PubChem CID 87178982) has the molecular formula C16H24N2O2S2Zn and a molecular weight of 405.90 g/mol. Its IUPAC name is zinc;N-(2,3-dibutylphenyl)carbamothioate;carbamothioate.
| Compound Name | zinc;N-(2,3-dibutylphenyl)carbamothioate;carbamothioate |
|---|---|
| PubChem CID | 87178982 |
| Molecular Formula | C16H24N2O2S2Zn |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | zinc;N-(2,3-dibutylphenyl)carbamothioate;carbamothioate |
| SMILES | CCCCc1cccc(NC(=O)[S-])c1CCCC.NC(=O)[S-].[Zn+2] |
| InChI | InChI=1S/C15H23NOS.CH3NOS.Zn/c1-3-5-8-12-9-7-11-14(16-15(17)18)13(12)10-6-4-2;2-1(3)4;/h7,9,11H,3-6,8,10H2,1-2H3,(H2,16,17,18);(H3,2,3,4);/q;;+2/p-2 |
| InChIKey | XBGYSZWYAAPSGV-UHFFFAOYSA-L |
| XLogP | 4.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|