C29H44N2O — CID 67224268
1,1-bis(2,3-dibutylphenyl)urea (PubChem CID 67224268) has the molecular formula C29H44N2O and a molecular weight of 436.68 g/mol. Its IUPAC name is 1,1-bis(2,3-dibutylphenyl)urea.
| Compound Name | 1,1-bis(2,3-dibutylphenyl)urea |
|---|---|
| PubChem CID | 67224268 |
| Molecular Formula | C29H44N2O |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | 1,1-bis(2,3-dibutylphenyl)urea |
| SMILES | CCCCc1cccc(N(C(N)=O)c2cccc(CCCC)c2CCCC)c1CCCC |
| InChI | InChI=1S/C29H44N2O/c1-5-9-15-23-17-13-21-27(25(23)19-11-7-3)31(29(30)32)28-22-14-18-24(16-10-6-2)26(28)20-12-8-4/h13-14,17-18,21-22H,5-12,15-16,19-20H2,1-4H3,(H2,30,32) |
| InChIKey | FOFYKWLPBDVWOX-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |