C30H44N2S6Zn — CID 172769568
zinc bis((2,3-dibutylphenyl)-sulfidocarbamodithioic acid) (PubChem CID 172769568) has the molecular formula C30H44N2S6Zn and a molecular weight of 690.49 g/mol. Its IUPAC name is zinc bis((2,3-dibutylphenyl)-sulfidocarbamodithioic acid).
| Compound Name | zinc bis((2,3-dibutylphenyl)-sulfidocarbamodithioic acid) |
|---|---|
| PubChem CID | 172769568 |
| Molecular Formula | C30H44N2S6Zn |
| Molecular Weight | 690.49 g/mol |
| Exact Mass | 688.11 |
| IUPAC Name | zinc bis((2,3-dibutylphenyl)-sulfidocarbamodithioic acid) |
| SMILES | CCCCc1cccc(N([S-])C(=S)S)c1CCCC.CCCCc1cccc(N([S-])C(=S)S)c1CCCC.[Zn+2] |
| InChI | InChI=1S/2C15H22NS3.Zn/c2*1-3-5-8-12-9-7-11-14(16(19)15(17)18)13(12)10-6-4-2;/h2*7,9,11H,3-6,8,10H2,1-2H3,(H,17,18);/q2*-1;+2 |
| InChIKey | FPRNWOYLIKXTGX-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.49 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|