C58H84N2S4Zn — CID 141237209
zinc bis(N,N-bis(2-octylphenyl)carbamodithioate) (PubChem CID 141237209) has the molecular formula C58H84N2S4Zn and a molecular weight of 1002.98 g/mol. Its IUPAC name is zinc bis(N,N-bis(2-octylphenyl)carbamodithioate).
| Compound Name | zinc bis(N,N-bis(2-octylphenyl)carbamodithioate) |
|---|---|
| PubChem CID | 141237209 |
| Molecular Formula | C58H84N2S4Zn |
| Molecular Weight | 1002.98 g/mol |
| Exact Mass | 1000.48 |
| IUPAC Name | zinc bis(N,N-bis(2-octylphenyl)carbamodithioate) |
| SMILES | CCCCCCCCc1ccccc1N(C(=S)[S-])c1ccccc1CCCCCCCC.CCCCCCCCc1ccccc1N(C(=S)[S-])c1ccccc1CCCCCCCC.[Zn+2] |
| InChI | InChI=1S/2C29H43NS2.Zn/c2*1-3-5-7-9-11-13-19-25-21-15-17-23-27(25)30(29(31)32)28-24-18-16-22-26(28)20-14-12-10-8-6-4-2;/h2*15-18,21-24H,3-14,19-20H2,1-2H3,(H,31,32);/q;;+2/p-2 |
| InChIKey | NHUHNNBPLFSNEH-UHFFFAOYSA-L |
| XLogP | 18.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.98 |
| LogP ≤ 5 | 18.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|