C21H27NOS2 — CID 18000653
hydroxy N,N-bis(2-butylphenyl)carbamodithioate (PubChem CID 18000653) has the molecular formula C21H27NOS2 and a molecular weight of 373.59 g/mol. Its IUPAC name is hydroxy N,N-bis(2-butylphenyl)carbamodithioate.
| Compound Name | hydroxy N,N-bis(2-butylphenyl)carbamodithioate |
|---|---|
| PubChem CID | 18000653 |
| Molecular Formula | C21H27NOS2 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | hydroxy N,N-bis(2-butylphenyl)carbamodithioate |
| SMILES | CCCCc1ccccc1N(C(=S)SO)c1ccccc1CCCC |
| InChI | InChI=1S/C21H27NOS2/c1-3-5-11-17-13-7-9-15-19(17)22(21(24)25-23)20-16-10-8-14-18(20)12-6-4-2/h7-10,13-16,23H,3-6,11-12H2,1-2H3 |
| InChIKey | PMHYUPBSPXTOBD-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|