C19H30FNO2 — CID 166461297
N-[2-fluoro-3-(7-methyl-6-oxononyl)phenyl]propanamide;molecular hydrogen (PubChem CID 166461297) has the molecular formula C19H30FNO2 and a molecular weight of 323.45 g/mol. Its IUPAC name is N-[2-fluoro-3-(7-methyl-6-oxononyl)phenyl]propanamide;molecular hydrogen.
| Compound Name | N-[2-fluoro-3-(7-methyl-6-oxononyl)phenyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 166461297 |
| Molecular Formula | C19H30FNO2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | N-[2-fluoro-3-(7-methyl-6-oxononyl)phenyl]propanamide;molecular hydrogen |
| SMILES | CCC(=O)Nc1cccc(CCCCCC(=O)C(C)CC)c1F.[H][H] |
| InChI | InChI=1S/C19H28FNO2.H2/c1-4-14(3)17(22)13-8-6-7-10-15-11-9-12-16(19(15)20)21-18(23)5-2;/h9,11-12,14H,4-8,10,13H2,1-3H3,(H,21,23);1H |
| InChIKey | WACAOUWHZLKREO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|