About N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane
N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane (PubChem CID 170951670) has the molecular formula C21H36FNO2
and a molecular weight of 353.52 g/mol. Its IUPAC name is N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane.
Molecular Properties
| Compound Name | N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane |
| PubChem CID | 170951670 |
| Molecular Formula | C21H36FNO2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane |
| SMILES | CC(C)C.CC(C)C=O.CCCCCCc1cccc(NC=O)c1F |
| InChI | InChI=1S/C13H18FNO.C4H8O.C4H10/c1-2-3-4-5-7-11-8-6-9-12(13(11)14)15-10-16;1-4(2)3-5;1-4(2)3/h6,8-10H,2-5,7H2,1H3,(H,15,16);3-4H,1-2H3;4H,1-3H3 |
| InChIKey | VCSVOOYFPKXYGM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane?
The IUPAC name of N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane (CID 170951670) is N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane.
What is the SMILES notation for N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane?
The canonical SMILES for N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane is CC(C)C.CC(C)C=O.CCCCCCc1cccc(NC=O)c1F.
What is the InChIKey of N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane?
The InChIKey is VCSVOOYFPKXYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO.C4H8O.C4H10/c1-2-3-4-5-7-11-8-6-9-12(13(11)14)15-10-16;1-4(2)3-5;1-4(2)3/h6,8-10H,2-5,7H2,1H3,(H,15,16);3-4H,1-2H3;4H,1-3H3.
What are the key properties of N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane?
N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane has a molecular weight of 353.52 g/mol, XLogP of 6.02, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoro-3-hexylphenyl)formamide;2-methylpropanal;2-methylpropane is sourced from PubChem (CID 170951670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).