C14H18ClNO2S — CID 157048722
6-(3-acetamido-2-chlorophenyl)hexanethioic S-acid (PubChem CID 157048722) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is 6-(3-acetamido-2-chlorophenyl)hexanethioic S-acid.
| Compound Name | 6-(3-acetamido-2-chlorophenyl)hexanethioic S-acid |
|---|---|
| PubChem CID | 157048722 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 6-(3-acetamido-2-chlorophenyl)hexanethioic S-acid |
| SMILES | CC(=O)Nc1cccc(CCCCCC(=O)S)c1Cl |
| InChI | InChI=1S/C14H18ClNO2S/c1-10(17)16-12-8-5-7-11(14(12)15)6-3-2-4-9-13(18)19/h5,7-8H,2-4,6,9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | KDCXJYFEOAIYEH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|