C17H24ClNO2S — CID 156858723
S-methyl 6-[2-chloro-3-(2-methylpropanoylamino)phenyl]hexanethioate (PubChem CID 156858723) has the molecular formula C17H24ClNO2S and a molecular weight of 341.90 g/mol. Its IUPAC name is S-methyl 6-[2-chloro-3-(2-methylpropanoylamino)phenyl]hexanethioate.
| Compound Name | S-methyl 6-[2-chloro-3-(2-methylpropanoylamino)phenyl]hexanethioate |
|---|---|
| PubChem CID | 156858723 |
| Molecular Formula | C17H24ClNO2S |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | S-methyl 6-[2-chloro-3-(2-methylpropanoylamino)phenyl]hexanethioate |
| SMILES | CSC(=O)CCCCCc1cccc(NC(=O)C(C)C)c1Cl |
| InChI | InChI=1S/C17H24ClNO2S/c1-12(2)17(21)19-14-10-7-9-13(16(14)18)8-5-4-6-11-15(20)22-3/h7,9-10,12H,4-6,8,11H2,1-3H3,(H,19,21) |
| InChIKey | PCPKDDLYYRISQB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|