C18H25Cl2NO3S — CID 91555757
2-(2,3-dichlorophenyl)ethyl N-tert-butyl-N-[3-(2-oxoethylsulfanyl)propyl]carbamate (PubChem CID 91555757) has the molecular formula C18H25Cl2NO3S and a molecular weight of 406.38 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)ethyl N-tert-butyl-N-[3-(2-oxoethylsulfanyl)propyl]carbamate.
| Compound Name | 2-(2,3-dichlorophenyl)ethyl N-tert-butyl-N-[3-(2-oxoethylsulfanyl)propyl]carbamate |
|---|---|
| PubChem CID | 91555757 |
| Molecular Formula | C18H25Cl2NO3S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-(2,3-dichlorophenyl)ethyl N-tert-butyl-N-[3-(2-oxoethylsulfanyl)propyl]carbamate |
| SMILES | CC(C)(C)N(CCCSCC=O)C(=O)OCCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H25Cl2NO3S/c1-18(2,3)21(9-5-12-25-13-10-22)17(23)24-11-8-14-6-4-7-15(19)16(14)20/h4,6-7,10H,5,8-9,11-13H2,1-3H3 |
| InChIKey | VPPHRFSFSGKTFK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|