C18H28ClNO3S — CID 59153322
tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[3-(2-hydroxyethylsulfanyl)propyl]carbamate (PubChem CID 59153322) has the molecular formula C18H28ClNO3S and a molecular weight of 373.95 g/mol. Its IUPAC name is tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[3-(2-hydroxyethylsulfanyl)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[3-(2-hydroxyethylsulfanyl)propyl]carbamate |
|---|---|
| PubChem CID | 59153322 |
| Molecular Formula | C18H28ClNO3S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[3-(2-hydroxyethylsulfanyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCSCCO)CCc1ccccc1Cl |
| InChI | InChI=1S/C18H28ClNO3S/c1-18(2,3)23-17(22)20(10-6-13-24-14-12-21)11-9-15-7-4-5-8-16(15)19/h4-5,7-8,21H,6,9-14H2,1-3H3 |
| InChIKey | NUBNJCLSKUEDMM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|