C19H31NO3S — CID 86633795
tert-butyl N-[2-(3-hydroxypropylsulfanyl)ethyl]-N-[(2R)-2-phenylpropyl]carbamate (PubChem CID 86633795) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is tert-butyl N-[2-(3-hydroxypropylsulfanyl)ethyl]-N-[(2R)-2-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-hydroxypropylsulfanyl)ethyl]-N-[(2R)-2-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 86633795 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl N-[2-(3-hydroxypropylsulfanyl)ethyl]-N-[(2R)-2-phenylpropyl]carbamate |
| SMILES | C[C@@H](CN(CCSCCCO)C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H31NO3S/c1-16(17-9-6-5-7-10-17)15-20(11-14-24-13-8-12-21)18(22)23-19(2,3)4/h5-7,9-10,16,21H,8,11-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | YXXSSZQEHNHXML-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|