C28H36N2O5 — CID 71045853
tert-butyl N-[5-(1-acetyl-2,3-dihydroindol-5-yl)-5-oxopentyl]-N-[2-(2-hydroxyphenyl)ethyl]carbamate (PubChem CID 71045853) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is tert-butyl N-[5-(1-acetyl-2,3-dihydroindol-5-yl)-5-oxopentyl]-N-[2-(2-hydroxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-acetyl-2,3-dihydroindol-5-yl)-5-oxopentyl]-N-[2-(2-hydroxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 71045853 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | tert-butyl N-[5-(1-acetyl-2,3-dihydroindol-5-yl)-5-oxopentyl]-N-[2-(2-hydroxyphenyl)ethyl]carbamate |
| SMILES | CC(=O)N1CCc2cc(C(=O)CCCCN(CCc3ccccc3O)C(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C28H36N2O5/c1-20(31)30-18-15-22-19-23(12-13-24(22)30)26(33)11-7-8-16-29(27(34)35-28(2,3)4)17-14-21-9-5-6-10-25(21)32/h5-6,9-10,12-13,19,32H,7-8,11,14-18H2,1-4H3 |
| InChIKey | RNHMZYAZHNGFHN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|