C24H31FN2O3 — CID 142261033
ethane;6-[5-[2-(2-fluorophenyl)ethyl-methylamino]pentanoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 142261033) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is ethane;6-[5-[2-(2-fluorophenyl)ethyl-methylamino]pentanoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | ethane;6-[5-[2-(2-fluorophenyl)ethyl-methylamino]pentanoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 142261033 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | ethane;6-[5-[2-(2-fluorophenyl)ethyl-methylamino]pentanoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC.CN(CCCCC(=O)c1ccc2c(c1)NC(=O)CO2)CCc1ccccc1F |
| InChI | InChI=1S/C22H25FN2O3.C2H6/c1-25(13-11-16-6-2-3-7-18(16)23)12-5-4-8-20(26)17-9-10-21-19(14-17)24-22(27)15-28-21;1-2/h2-3,6-7,9-10,14H,4-5,8,11-13,15H2,1H3,(H,24,27);1-2H3 |
| InChIKey | RRSWPUKUIZBXID-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|