C20H20N2O4 — CID 110344950
4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-N-(2-phenylethyl)butanamide (PubChem CID 110344950) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-N-(2-phenylethyl)butanamide.
| Compound Name | 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 110344950 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-N-(2-phenylethyl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)NC(=O)CO2)NCCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c23-17(15-6-8-18-16(12-15)22-20(25)13-26-18)7-9-19(24)21-11-10-14-4-2-1-3-5-14/h1-6,8,12H,7,9-11,13H2,(H,21,24)(H,22,25) |
| InChIKey | WQWKCEUFBONDJV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |