C18H15ClN2O4 — CID 110344996
N-(3-chlorophenyl)-4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide (PubChem CID 110344996) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide.
| Compound Name | N-(3-chlorophenyl)-4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide |
|---|---|
| PubChem CID | 110344996 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(3-chlorophenyl)-4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)NC(=O)CO2)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-12-2-1-3-13(9-12)20-17(23)7-5-15(22)11-4-6-16-14(8-11)21-18(24)10-25-16/h1-4,6,8-9H,5,7,10H2,(H,20,23)(H,21,24) |
| InChIKey | FAZBMUXWJIGXLY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |