C16H18N2O6 — CID 82033923
2-[[4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoyl]amino]butanoic acid (PubChem CID 82033923) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[[4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoyl]amino]butanoic acid.
| Compound Name | 2-[[4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 82033923 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[[4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)CCC(=O)c1ccc2c(c1)NC(=O)CO2)C(=O)O |
| InChI | InChI=1S/C16H18N2O6/c1-2-10(16(22)23)17-14(20)6-4-12(19)9-3-5-13-11(7-9)18-15(21)8-24-13/h3,5,7,10H,2,4,6,8H2,1H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | PMCMJAYIJNKCGU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |