C21H25N3O2 — CID 11653229
5-[5-[methyl(2-phenylethyl)amino]pentanoyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 11653229) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-[5-[methyl(2-phenylethyl)amino]pentanoyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[5-[methyl(2-phenylethyl)amino]pentanoyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 11653229 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 5-[5-[methyl(2-phenylethyl)amino]pentanoyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CN(CCCCC(=O)c1ccc2[nH]c(=O)[nH]c2c1)CCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-24(14-12-16-7-3-2-4-8-16)13-6-5-9-20(25)17-10-11-18-19(15-17)23-21(26)22-18/h2-4,7-8,10-11,15H,5-6,9,12-14H2,1H3,(H2,22,23,26) |
| InChIKey | PYTZUNLGJAPTOZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|