C10H11N3O2 — CID 22745221
N,N-dimethyl-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide (PubChem CID 22745221) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N,N-dimethyl-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide.
| Compound Name | N,N-dimethyl-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 22745221 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N,N-dimethyl-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H11N3O2/c1-13(2)9(14)6-3-4-7-8(5-6)12-10(15)11-7/h3-5H,1-2H3,(H2,11,12,15) |
| InChIKey | SGESRRMRTICEMW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |