C14H14O8 — CID 174610946
2-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]terephthalic acid (PubChem CID 174610946) has the molecular formula C14H14O8 and a molecular weight of 310.26 g/mol. Its IUPAC name is 2-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]terephthalic acid.
| Compound Name | 2-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]terephthalic acid |
|---|---|
| PubChem CID | 174610946 |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c([C@@]2(O)CO[C@@H]3[C@H](O)CO[C@@H]32)c1 |
| InChI | InChI=1S/C14H14O8/c15-9-4-21-11-10(9)22-5-14(11,20)8-3-6(12(16)17)1-2-7(8)13(18)19/h1-3,9-11,15,20H,4-5H2,(H,16,17)(H,18,19)/t9-,10-,11+,14+/m1/s1 |
| InChIKey | WUUFOTGVDFXWIC-PUHVVEEASA-N |
| XLogP | -0.57 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |