C13H15NO6S2 — CID 18343811
6-ethyl-8-(methylamino)naphthalene-1,3-disulfonic acid (PubChem CID 18343811) has the molecular formula C13H15NO6S2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 6-ethyl-8-(methylamino)naphthalene-1,3-disulfonic acid.
| Compound Name | 6-ethyl-8-(methylamino)naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 18343811 |
| Molecular Formula | C13H15NO6S2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 6-ethyl-8-(methylamino)naphthalene-1,3-disulfonic acid |
| SMILES | CCc1cc(NC)c2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C13H15NO6S2/c1-3-8-4-9-6-10(21(15,16)17)7-12(22(18,19)20)13(9)11(5-8)14-2/h4-7,14H,3H2,1-2H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | BCEKQTWPWUXHOE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|