C17H16N2O11S4 — CID 86736546
8-[(4-amino-2-methylphenyl)sulfonylamino]naphthalene-1,3,6-trisulfonic acid (PubChem CID 86736546) has the molecular formula C17H16N2O11S4 and a molecular weight of 552.59 g/mol. Its IUPAC name is 8-[(4-amino-2-methylphenyl)sulfonylamino]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 8-[(4-amino-2-methylphenyl)sulfonylamino]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 86736546 |
| Molecular Formula | C17H16N2O11S4 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 551.96 |
| IUPAC Name | 8-[(4-amino-2-methylphenyl)sulfonylamino]naphthalene-1,3,6-trisulfonic acid |
| SMILES | Cc1cc(N)ccc1S(=O)(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C17H16N2O11S4/c1-9-4-11(18)2-3-15(9)31(20,21)19-14-7-12(32(22,23)24)5-10-6-13(33(25,26)27)8-16(17(10)14)34(28,29)30/h2-8,19H,18H2,1H3,(H,22,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | KDGNWJZFAOQELZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 235.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|