C17H16N2O9S3 — CID 89206086
8-[(4-aminophenyl)methylamino]naphthalene-1,3,6-trisulfonic acid (PubChem CID 89206086) has the molecular formula C17H16N2O9S3 and a molecular weight of 488.52 g/mol. Its IUPAC name is 8-[(4-aminophenyl)methylamino]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 8-[(4-aminophenyl)methylamino]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 89206086 |
| Molecular Formula | C17H16N2O9S3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 8-[(4-aminophenyl)methylamino]naphthalene-1,3,6-trisulfonic acid |
| SMILES | Nc1ccc(CNc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1 |
| InChI | InChI=1S/C17H16N2O9S3/c18-12-3-1-10(2-4-12)9-19-15-7-13(29(20,21)22)5-11-6-14(30(23,24)25)8-16(17(11)15)31(26,27)28/h1-8,19H,9,18H2,(H,20,21,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | QIBVZRMRJMFAHP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 201.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|