C18H21N3O6S4 — CID 174994671
3-ethyl-2-[(3-ethyl-6-sulfo-3H-1,2-benzothiazol-2-yl)amino]-3H-1,2-benzothiazole-6-sulfonic acid (PubChem CID 174994671) has the molecular formula C18H21N3O6S4 and a molecular weight of 503.65 g/mol. Its IUPAC name is 3-ethyl-2-[(3-ethyl-6-sulfo-3H-1,2-benzothiazol-2-yl)amino]-3H-1,2-benzothiazole-6-sulfonic acid.
| Compound Name | 3-ethyl-2-[(3-ethyl-6-sulfo-3H-1,2-benzothiazol-2-yl)amino]-3H-1,2-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 174994671 |
| Molecular Formula | C18H21N3O6S4 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 3-ethyl-2-[(3-ethyl-6-sulfo-3H-1,2-benzothiazol-2-yl)amino]-3H-1,2-benzothiazole-6-sulfonic acid |
| SMILES | CCC1c2ccc(S(=O)(=O)O)cc2SN1NN1Sc2cc(S(=O)(=O)O)ccc2C1CC |
| InChI | InChI=1S/C18H21N3O6S4/c1-3-15-13-7-5-11(30(22,23)24)9-17(13)28-20(15)19-21-16(4-2)14-8-6-12(31(25,26)27)10-18(14)29-21/h5-10,15-16,19H,3-4H2,1-2H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | KDIXDZBIRKHFMJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|