C21H10F6O6S4 — CID 102333733
12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17(22),18,20-octaene-6,20-disulfonic acid (PubChem CID 102333733) has the molecular formula C21H10F6O6S4 and a molecular weight of 600.56 g/mol. Its IUPAC name is 12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17(22),18,20-octaene-6,20-disulfonic acid.
| Compound Name | 12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17(22),18,20-octaene-6,20-disulfonic acid |
|---|---|
| PubChem CID | 102333733 |
| Molecular Formula | C21H10F6O6S4 |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 599.93 |
| IUPAC Name | 12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17(22),18,20-octaene-6,20-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)SC1C2=C2C(=C3c4ccc(S(=O)(=O)O)cc4SC31)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C21H10F6O6S4/c22-19(23)15-13-9-3-1-7(36(28,29)30)5-11(9)34-17(13)18-14(16(15)20(24,25)21(19,26)27)10-4-2-8(37(31,32)33)6-12(10)35-18/h1-6,17-18H,(H,28,29,30)(H,31,32,33) |
| InChIKey | BZXAXBXAIZPUIH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|