C27H18F6O6S4 — CID 102431969
4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(4-sulfophenyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]benzenesulfonic acid (PubChem CID 102431969) has the molecular formula C27H18F6O6S4 and a molecular weight of 680.69 g/mol. Its IUPAC name is 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(4-sulfophenyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]benzenesulfonic acid.
| Compound Name | 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(4-sulfophenyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102431969 |
| Molecular Formula | C27H18F6O6S4 |
| Molecular Weight | 680.69 g/mol |
| Exact Mass | 679.99 |
| IUPAC Name | 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(4-sulfophenyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]benzenesulfonic acid |
| SMILES | CC12SC(c3ccc(S(=O)(=O)O)cc3)=CC1=C1C(=C3C=C(c4ccc(S(=O)(=O)O)cc4)SC32C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C27H18F6O6S4/c1-23-17(11-19(40-23)13-3-7-15(8-4-13)42(34,35)36)21-22(26(30,31)27(32,33)25(21,28)29)18-12-20(41-24(18,23)2)14-5-9-16(10-6-14)43(37,38)39/h3-12H,1-2H3,(H,34,35,36)(H,37,38,39) |
| InChIKey | AVCKXUSHXPINMP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|