C37H26F6O10S4 — CID 122386727
4-[2-ethyl-3-[2-[2-ethyl-1,1-dioxo-6-(4-sulfophenyl)-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,1-dioxo-1-benzothiophen-6-yl]benzenesulfonic acid (PubChem CID 122386727) has the molecular formula C37H26F6O10S4 and a molecular weight of 872.86 g/mol. Its IUPAC name is 4-[2-ethyl-3-[2-[2-ethyl-1,1-dioxo-6-(4-sulfophenyl)-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,1-dioxo-1-benzothiophen-6-yl]benzenesulfonic acid.
| Compound Name | 4-[2-ethyl-3-[2-[2-ethyl-1,1-dioxo-6-(4-sulfophenyl)-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,1-dioxo-1-benzothiophen-6-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 122386727 |
| Molecular Formula | C37H26F6O10S4 |
| Molecular Weight | 872.86 g/mol |
| Exact Mass | 872.03 |
| IUPAC Name | 4-[2-ethyl-3-[2-[2-ethyl-1,1-dioxo-6-(4-sulfophenyl)-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,1-dioxo-1-benzothiophen-6-yl]benzenesulfonic acid |
| SMILES | CCC1=C(C2=C(C3=C(CC)S(=O)(=O)c4cc(-c5ccc(S(=O)(=O)O)cc5)ccc43)C(F)(F)C(F)(F)C2(F)F)c2ccc(-c3ccc(S(=O)(=O)O)cc3)cc2S1(=O)=O |
| InChI | InChI=1S/C37H26F6O10S4/c1-3-27-31(25-15-9-21(17-29(25)54(27,44)45)19-5-11-23(12-6-19)56(48,49)50)33-34(36(40,41)37(42,43)35(33,38)39)32-26-16-10-22(18-30(26)55(46,47)28(32)4-2)20-7-13-24(14-8-20)57(51,52)53/h5-18H,3-4H2,1-2H3,(H,48,49,50)(H,51,52,53) |
| InChIKey | SOIKCGCDMHUFOZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.86 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|