C24H18O8S3 — CID 87077314
4-[5,5-dihydroxy-7-(4-sulfophenyl)dibenzothiophen-3-yl]benzenesulfonic acid (PubChem CID 87077314) has the molecular formula C24H18O8S3 and a molecular weight of 530.60 g/mol. Its IUPAC name is 4-[5,5-dihydroxy-7-(4-sulfophenyl)dibenzothiophen-3-yl]benzenesulfonic acid.
| Compound Name | 4-[5,5-dihydroxy-7-(4-sulfophenyl)dibenzothiophen-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87077314 |
| Molecular Formula | C24H18O8S3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 4-[5,5-dihydroxy-7-(4-sulfophenyl)dibenzothiophen-3-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2ccc3c(c2)S(O)(O)c2cc(-c4ccc(S(=O)(=O)O)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C24H18O8S3/c25-33(26)23-13-17(15-1-7-19(8-2-15)34(27,28)29)5-11-21(23)22-12-6-18(14-24(22)33)16-3-9-20(10-4-16)35(30,31)32/h1-14,25-26H,(H,27,28,29)(H,30,31,32) |
| InChIKey | UPIKHHSWGYKSKI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|