C10H11NOS — CID 84619183
2,5-dimethyl-4H-1,4-benzothiazin-3-one (PubChem CID 84619183) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2,5-dimethyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 2,5-dimethyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84619183 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2,5-dimethyl-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc2c1NC(=O)C(C)S2 |
| InChI | InChI=1S/C10H11NOS/c1-6-4-3-5-8-9(6)11-10(12)7(2)13-8/h3-5,7H,1-2H3,(H,11,12) |
| InChIKey | WZTYFAMQYTYDAB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |