About 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride
3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride (PubChem CID 126477073) has the molecular formula C8H9ClN2OS
and a molecular weight of 216.69 g/mol. Its IUPAC name is 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride |
| PubChem CID | 126477073 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride |
| SMILES | CC1Sc2ncccc2NC1=O.Cl |
| InChI | InChI=1S/C8H8N2OS.ClH/c1-5-7(11)10-6-3-2-4-9-8(6)12-5;/h2-5H,1H3,(H,10,11);1H |
| InChIKey | OIOXFYRXUAEFCL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride?
The IUPAC name of 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride (CID 126477073) is 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride.
What is the SMILES notation for 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride?
The canonical SMILES for 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride is CC1Sc2ncccc2NC1=O.Cl.
What is the InChIKey of 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride?
The InChIKey is OIOXFYRXUAEFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS.ClH/c1-5-7(11)10-6-3-2-4-9-8(6)12-5;/h2-5H,1H3,(H,10,11);1H.
What are the key properties of 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride?
3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride has a molecular weight of 216.69 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one;hydrochloride is sourced from PubChem (CID 126477073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).