C8H7ClN2OS — CID 114827395
7-chloro-3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one (PubChem CID 114827395) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is 7-chloro-3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one.
| Compound Name | 7-chloro-3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one |
|---|---|
| PubChem CID | 114827395 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 7-chloro-3-methyl-1H-pyrido[2,3-b][1,4]thiazin-2-one |
| SMILES | CC1Sc2ncc(Cl)cc2NC1=O |
| InChI | InChI=1S/C8H7ClN2OS/c1-4-7(12)11-6-2-5(9)3-10-8(6)13-4/h2-4H,1H3,(H,11,12) |
| InChIKey | XCMOFEZQKGXSNH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |