C16H22N4O2S — CID 155721935
1-azaspiro[2.5]octane;2-(2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetamide (PubChem CID 155721935) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-azaspiro[2.5]octane;2-(2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetamide.
| Compound Name | 1-azaspiro[2.5]octane;2-(2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetamide |
|---|---|
| PubChem CID | 155721935 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-azaspiro[2.5]octane;2-(2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetamide |
| SMILES | C1CCC2(CC1)CN2.NC(=O)CC1Sc2ncccc2NC1=O |
| InChI | InChI=1S/C9H9N3O2S.C7H13N/c10-7(13)4-6-8(14)12-5-2-1-3-11-9(5)15-6;1-2-4-7(5-3-1)6-8-7/h1-3,6H,4H2,(H2,10,13)(H,12,14);8H,1-6H2 |
| InChIKey | DMSGFUIVRLOVGS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|