C10H12N2O — CID 131142499
(3S)-3,8-dimethyl-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 131142499) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (3S)-3,8-dimethyl-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | (3S)-3,8-dimethyl-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 131142499 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (3S)-3,8-dimethyl-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | Cc1cccc2c1NC(=O)[C@H](C)N2 |
| InChI | InChI=1S/C10H12N2O/c1-6-4-3-5-8-9(6)12-10(13)7(2)11-8/h3-5,7,11H,1-2H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | PMZSDMXBBFJFAO-ZETCQYMHSA-N |
| XLogP | 1.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |