C13H15NO — CID 144561524
(2E)-2-ethylidene-3,8-dimethyl-1H-quinolin-4-one (PubChem CID 144561524) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (2E)-2-ethylidene-3,8-dimethyl-1H-quinolin-4-one.
| Compound Name | (2E)-2-ethylidene-3,8-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 144561524 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2E)-2-ethylidene-3,8-dimethyl-1H-quinolin-4-one |
| SMILES | C/C=C1/Nc2c(C)cccc2C(=O)C1C |
| InChI | InChI=1S/C13H15NO/c1-4-11-9(3)13(15)10-7-5-6-8(2)12(10)14-11/h4-7,9,14H,1-3H3/b11-4+ |
| InChIKey | VSEVZECTBYAGNC-NYYWCZLTSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |