C10H11NO — CID 56636550
3,4-dimethyl-2,3-dihydroisoindol-1-one (PubChem CID 56636550) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 3,4-dimethyl-2,3-dihydroisoindol-1-one.
| Compound Name | 3,4-dimethyl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 56636550 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3,4-dimethyl-2,3-dihydroisoindol-1-one |
| SMILES | Cc1cccc2c1C(C)NC2=O |
| InChI | InChI=1S/C10H11NO/c1-6-4-3-5-8-9(6)7(2)11-10(8)12/h3-5,7H,1-2H3,(H,11,12) |
| InChIKey | RVCINIJMSIKPCV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |