C9H8INO — CID 143900412
3-iodo-4-methyl-2,3-dihydroisoindol-1-one (PubChem CID 143900412) has the molecular formula C9H8INO and a molecular weight of 273.07 g/mol. Its IUPAC name is 3-iodo-4-methyl-2,3-dihydroisoindol-1-one.
| Compound Name | 3-iodo-4-methyl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 143900412 |
| Molecular Formula | C9H8INO |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 3-iodo-4-methyl-2,3-dihydroisoindol-1-one |
| SMILES | Cc1cccc2c1C(I)NC2=O |
| InChI | InChI=1S/C9H8INO/c1-5-3-2-4-6-7(5)8(10)11-9(6)12/h2-4,8H,1H3,(H,11,12) |
| InChIKey | ZKPYSTYODNPFEI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|