C12H15NO — CID 82504593
3-(2-aminoethyl)-4-methyl-2,3-dihydroinden-1-one (PubChem CID 82504593) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4-methyl-2,3-dihydroinden-1-one.
| Compound Name | 3-(2-aminoethyl)-4-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 82504593 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-(2-aminoethyl)-4-methyl-2,3-dihydroinden-1-one |
| SMILES | Cc1cccc2c1C(CCN)CC2=O |
| InChI | InChI=1S/C12H15NO/c1-8-3-2-4-10-11(14)7-9(5-6-13)12(8)10/h2-4,9H,5-7,13H2,1H3 |
| InChIKey | FIVDJRZSLFTJHC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |