C16H21NO2 — CID 110677605
N-butyl-N,7-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide (PubChem CID 110677605) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-butyl-N,7-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide.
| Compound Name | N-butyl-N,7-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 110677605 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-butyl-N,7-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CC(=O)c2cccc(C)c21 |
| InChI | InChI=1S/C16H21NO2/c1-4-5-9-17(3)16(19)13-10-14(18)12-8-6-7-11(2)15(12)13/h6-8,13H,4-5,9-10H2,1-3H3 |
| InChIKey | AFHXLBJWIFRKAR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |