C19H23NO2 — CID 110677532
N-[2-(cyclohexen-1-yl)ethyl]-7-methyl-3-oxo-1,2-dihydroindene-1-carboxamide (PubChem CID 110677532) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-7-methyl-3-oxo-1,2-dihydroindene-1-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-7-methyl-3-oxo-1,2-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 110677532 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-7-methyl-3-oxo-1,2-dihydroindene-1-carboxamide |
| SMILES | Cc1cccc2c1C(C(=O)NCCC1=CCCCC1)CC2=O |
| InChI | InChI=1S/C19H23NO2/c1-13-6-5-9-15-17(21)12-16(18(13)15)19(22)20-11-10-14-7-3-2-4-8-14/h5-7,9,16H,2-4,8,10-12H2,1H3,(H,20,22) |
| InChIKey | NAQLNLTVOLJUOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|