C8H5F2NO — CID 23221400
3,4-difluoro-2,3-dihydroisoindol-1-one (PubChem CID 23221400) has the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. Its IUPAC name is 3,4-difluoro-2,3-dihydroisoindol-1-one.
| Compound Name | 3,4-difluoro-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 23221400 |
| Molecular Formula | C8H5F2NO |
| Molecular Weight | 169.13 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 3,4-difluoro-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(F)c2c(F)cccc21 |
| InChI | InChI=1S/C8H5F2NO/c9-5-3-1-2-4-6(5)7(10)11-8(4)12/h1-3,7H,(H,11,12) |
| InChIKey | FUSNSKQVSNLVQB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|