C9H11ClF2N4O — CID 23221399
3,4-difluoro-2,3-dihydroisoindol-1-one;guanidine;hydrochloride (PubChem CID 23221399) has the molecular formula C9H11ClF2N4O and a molecular weight of 264.66 g/mol. Its IUPAC name is 3,4-difluoro-2,3-dihydroisoindol-1-one;guanidine;hydrochloride.
| Compound Name | 3,4-difluoro-2,3-dihydroisoindol-1-one;guanidine;hydrochloride |
|---|---|
| PubChem CID | 23221399 |
| Molecular Formula | C9H11ClF2N4O |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3,4-difluoro-2,3-dihydroisoindol-1-one;guanidine;hydrochloride |
| SMILES | Cl.O=C1NC(F)c2c(F)cccc21.[H]N=C(N)N |
| InChI | InChI=1S/C8H5F2NO.CH5N3.ClH/c9-5-3-1-2-4-6(5)7(10)11-8(4)12;2-1(3)4;/h1-3,7H,(H,11,12);(H5,2,3,4);1H |
| InChIKey | ZMWGGKFUSCHSHQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|