About (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate
(7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate (PubChem CID 22025510) has the molecular formula C14H16FNO3
and a molecular weight of 265.28 g/mol. Its IUPAC name is (7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate.
Molecular Properties
| Compound Name | (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate |
| PubChem CID | 22025510 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OC1C2=C(C=CC=C2F)C(=O)N1 |
| InChI | InChI=1S/C14H16FNO3/c1-8(2)6-7-11(17)19-14-12-9(13(18)16-14)4-3-5-10(12)15/h3-5,8,14H,6-7H2,1-2H3,(H,16,18) |
| InChIKey | CADVVFALKCYGGK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | 359 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate?
The IUPAC name of (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate (CID 22025510) is (7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate.
What is the SMILES notation for (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate?
The canonical SMILES for (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate is CC(C)CCC(=O)OC1C2=C(C=CC=C2F)C(=O)N1.
What is the InChIKey of (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate?
The InChIKey is CADVVFALKCYGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO3/c1-8(2)6-7-11(17)19-14-12-9(13(18)16-14)4-3-5-10(12)15/h3-5,8,14H,6-7H2,1-2H3,(H,16,18).
What are the key properties of (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate?
(7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate has a molecular weight of 265.28 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-Fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate is sourced from PubChem (CID 22025510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).