C14H16FNO3 — CID 22025510
(7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate (PubChem CID 22025510) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is (7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate.
| Compound Name | (7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate |
|---|---|
| PubChem CID | 22025510 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (7-fluoro-3-oxo-1,2-dihydroisoindol-1-yl) 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OC1NC(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C14H16FNO3/c1-8(2)6-7-11(17)19-14-12-9(13(18)16-14)4-3-5-10(12)15/h3-5,8,14H,6-7H2,1-2H3,(H,16,18) |
| InChIKey | CADVVFALKCYGGK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |