C25H42NO5PS — CID 70372822
bis(6-methylheptyl) hydrogen phosphite;4-methylsulfanylisoindole-1,3-dione (PubChem CID 70372822) has the molecular formula C25H42NO5PS and a molecular weight of 499.65 g/mol. Its IUPAC name is bis(6-methylheptyl) hydrogen phosphite;4-methylsulfanylisoindole-1,3-dione.
| Compound Name | bis(6-methylheptyl) hydrogen phosphite;4-methylsulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 70372822 |
| Molecular Formula | C25H42NO5PS |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | bis(6-methylheptyl) hydrogen phosphite;4-methylsulfanylisoindole-1,3-dione |
| SMILES | CC(C)CCCCCOP(O)OCCCCCC(C)C.CSc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C16H35O3P.C9H7NO2S/c1-15(2)11-7-5-9-13-18-20(17)19-14-10-6-8-12-16(3)4;1-13-6-4-2-3-5-7(6)9(12)10-8(5)11/h15-17H,5-14H2,1-4H3;2-4H,1H3,(H,10,11,12) |
| InChIKey | RIHQFTYUYIAANP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|