About 8-methylnonyl phenyl phosphite
8-methylnonyl phenyl phosphite (PubChem CID 154063362) has the molecular formula C16H26O3P-
and a molecular weight of 297.35 g/mol. Its IUPAC name is 8-methylnonyl phenyl phosphite.
Molecular Properties
| Compound Name | 8-methylnonyl phenyl phosphite |
| PubChem CID | 154063362 |
| Molecular Formula | C16H26O3P- |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 8-methylnonyl phenyl phosphite |
| SMILES | CC(C)CCCCCCCOP([O-])Oc1ccccc1 |
| InChI | InChI=1S/C16H26O3P/c1-15(2)11-7-4-3-5-10-14-18-20(17)19-16-12-8-6-9-13-16/h6,8-9,12-13,15H,3-5,7,10-11,14H2,1-2H3/q-1 |
| InChIKey | YNMCRACTFYPWPN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnonyl phenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnonyl phenyl phosphite?
The IUPAC name of 8-methylnonyl phenyl phosphite (CID 154063362) is 8-methylnonyl phenyl phosphite.
What is the SMILES notation for 8-methylnonyl phenyl phosphite?
The canonical SMILES for 8-methylnonyl phenyl phosphite is CC(C)CCCCCCCOP([O-])Oc1ccccc1.
What is the InChIKey of 8-methylnonyl phenyl phosphite?
The InChIKey is YNMCRACTFYPWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3P/c1-15(2)11-7-4-3-5-10-14-18-20(17)19-16-12-8-6-9-13-16/h6,8-9,12-13,15H,3-5,7,10-11,14H2,1-2H3/q-1.
What are the key properties of 8-methylnonyl phenyl phosphite?
8-methylnonyl phenyl phosphite has a molecular weight of 297.35 g/mol, XLogP of 4.67, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnonyl phenyl phosphite is sourced from PubChem (CID 154063362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).