C15H23Cl — CID 83169221
(1-chloro-7-methyloctyl)benzene (PubChem CID 83169221) has the molecular formula C15H23Cl and a molecular weight of 238.80 g/mol. Its IUPAC name is (1-chloro-7-methyloctyl)benzene.
| Compound Name | (1-chloro-7-methyloctyl)benzene |
|---|---|
| PubChem CID | 83169221 |
| Molecular Formula | C15H23Cl |
| Molecular Weight | 238.80 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (1-chloro-7-methyloctyl)benzene |
| SMILES | CC(C)CCCCCC(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H23Cl/c1-13(2)9-5-3-8-12-15(16)14-10-6-4-7-11-14/h4,6-7,10-11,13,15H,3,5,8-9,12H2,1-2H3 |
| InChIKey | BBAAFEBLTNWHPF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|