C18H17NO2S — CID 595813
2-phenylethyl 3-methyl-4H-1,4-benzothiazine-2-carboxylate (PubChem CID 595813) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-phenylethyl 3-methyl-4H-1,4-benzothiazine-2-carboxylate.
| Compound Name | 2-phenylethyl 3-methyl-4H-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 595813 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-phenylethyl 3-methyl-4H-1,4-benzothiazine-2-carboxylate |
| SMILES | CC1=C(C(=O)OCCc2ccccc2)Sc2ccccc2N1 |
| InChI | InChI=1S/C18H17NO2S/c1-13-17(22-16-10-6-5-9-15(16)19-13)18(20)21-12-11-14-7-3-2-4-8-14/h2-10,19H,11-12H2,1H3 |
| InChIKey | YQZFWNDSEARPOZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|