About cyclohexanol;10H-phenothiazine
cyclohexanol;10H-phenothiazine (PubChem CID 144921542) has the molecular formula C18H21NOS
and a molecular weight of 299.44 g/mol. Its IUPAC name is cyclohexanol;10H-phenothiazine.
Molecular Properties
| Compound Name | cyclohexanol;10H-phenothiazine |
| PubChem CID | 144921542 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | cyclohexanol;10H-phenothiazine |
| SMILES | OC1CCCCC1.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.C6H12O/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;7-6-4-2-1-3-5-6/h1-8,13H;6-7H,1-5H2 |
| InChIKey | ACQARGCZITVLBV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanol;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;10H-phenothiazine?
The IUPAC name of cyclohexanol;10H-phenothiazine (CID 144921542) is cyclohexanol;10H-phenothiazine.
What is the SMILES notation for cyclohexanol;10H-phenothiazine?
The canonical SMILES for cyclohexanol;10H-phenothiazine is OC1CCCCC1.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of cyclohexanol;10H-phenothiazine?
The InChIKey is ACQARGCZITVLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.C6H12O/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;7-6-4-2-1-3-5-6/h1-8,13H;6-7H,1-5H2.
What are the key properties of cyclohexanol;10H-phenothiazine?
cyclohexanol;10H-phenothiazine has a molecular weight of 299.44 g/mol, XLogP of 5.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;10H-phenothiazine is sourced from PubChem (CID 144921542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).